C25H21N7O2 — CID 24955117
3-[8-(4-methoxyphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 24955117) has the molecular formula C25H21N7O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-[8-(4-methoxyphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[8-(4-methoxyphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 24955117 |
| Molecular Formula | C25H21N7O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 3-[8-(4-methoxyphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | COc1ccc(-c2nc3cnc(-n4cnc5ccc(C#N)cc54)nc3n2C2CCOCC2)cc1 |
| InChI | InChI=1S/C25H21N7O2/c1-33-19-5-3-17(4-6-19)23-29-21-14-27-25(30-24(21)32(23)18-8-10-34-11-9-18)31-15-28-20-7-2-16(13-26)12-22(20)31/h2-7,12,14-15,18H,8-11H2,1H3 |
| InChIKey | ZPQAVPGUCQCUSD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |