C23H21ClN8O — CID 59704991
2-(6-chlorobenzimidazol-1-yl)-9-(4-methoxycyclohexyl)-8-pyrimidin-5-ylpurine (PubChem CID 59704991) has the molecular formula C23H21ClN8O and a molecular weight of 460.93 g/mol. Its IUPAC name is 2-(6-chlorobenzimidazol-1-yl)-9-(4-methoxycyclohexyl)-8-pyrimidin-5-ylpurine.
| Compound Name | 2-(6-chlorobenzimidazol-1-yl)-9-(4-methoxycyclohexyl)-8-pyrimidin-5-ylpurine |
|---|---|
| PubChem CID | 59704991 |
| Molecular Formula | C23H21ClN8O |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-(6-chlorobenzimidazol-1-yl)-9-(4-methoxycyclohexyl)-8-pyrimidin-5-ylpurine |
| SMILES | COC1CCC(n2c(-c3cncnc3)nc3cnc(-n4cnc5ccc(Cl)cc54)nc32)CC1 |
| InChI | InChI=1S/C23H21ClN8O/c1-33-17-5-3-16(4-6-17)32-21(14-9-25-12-26-10-14)29-19-11-27-23(30-22(19)32)31-13-28-18-7-2-15(24)8-20(18)31/h2,7-13,16-17H,3-6H2,1H3 |
| InChIKey | RVZRIKVIXXFDNQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |