About 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine
9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine (PubChem CID 24745012) has the molecular formula C21H20N6O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine.
Molecular Properties
| Compound Name | 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine |
| PubChem CID | 24745012 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine |
| SMILES | COc1ccc(Nc2ncc3nc(-c4ccncc4)n(C4CC4)c3n2)c(OC)c1 |
| InChI | InChI=1S/C21H20N6O2/c1-28-15-5-6-16(18(11-15)29-2)25-21-23-12-17-20(26-21)27(14-3-4-14)19(24-17)13-7-9-22-10-8-13/h5-12,14H,3-4H2,1-2H3,(H,23,25,26) |
| InChIKey | NPAPKEPLPPFZHX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine?
The IUPAC name of 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine (CID 24745012) is 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine.
What is the SMILES notation for 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine?
The canonical SMILES for 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine is COc1ccc(Nc2ncc3nc(-c4ccncc4)n(C4CC4)c3n2)c(OC)c1.
What is the InChIKey of 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine?
The InChIKey is NPAPKEPLPPFZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O2/c1-28-15-5-6-16(18(11-15)29-2)25-21-23-12-17-20(26-21)27(14-3-4-14)19(24-17)13-7-9-22-10-8-13/h5-12,14H,3-4H2,1-2H3,(H,23,25,26).
What are the key properties of 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine?
9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine has a molecular weight of 388.43 g/mol, XLogP of 3.98, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopropyl-N-(2,4-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine is sourced from PubChem (CID 24745012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).