C21H20N6O2 — CID 142780304
9-cyclopropyl-6-(3,5-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine (PubChem CID 142780304) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 9-cyclopropyl-6-(3,5-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine.
| Compound Name | 9-cyclopropyl-6-(3,5-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine |
|---|---|
| PubChem CID | 142780304 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 9-cyclopropyl-6-(3,5-dimethoxyphenyl)-8-pyridin-4-ylpurin-2-amine |
| SMILES | COc1cc(OC)cc(-c2nc(N)nc3c2nc(-c2ccncc2)n3C2CC2)c1 |
| InChI | InChI=1S/C21H20N6O2/c1-28-15-9-13(10-16(11-15)29-2)17-18-20(26-21(22)25-17)27(14-3-4-14)19(24-18)12-5-7-23-8-6-12/h5-11,14H,3-4H2,1-2H3,(H2,22,25,26) |
| InChIKey | IKPFSCIOPGOCEW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |