C24H20ClN7O — CID 143654620
4-[2-(6-chlorobenzimidazol-1-yl)-8-methyl-6-pyridin-4-ylpurin-9-yl]cyclohexan-1-one (PubChem CID 143654620) has the molecular formula C24H20ClN7O and a molecular weight of 457.93 g/mol. Its IUPAC name is 4-[2-(6-chlorobenzimidazol-1-yl)-8-methyl-6-pyridin-4-ylpurin-9-yl]cyclohexan-1-one.
| Compound Name | 4-[2-(6-chlorobenzimidazol-1-yl)-8-methyl-6-pyridin-4-ylpurin-9-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 143654620 |
| Molecular Formula | C24H20ClN7O |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-[2-(6-chlorobenzimidazol-1-yl)-8-methyl-6-pyridin-4-ylpurin-9-yl]cyclohexan-1-one |
| SMILES | Cc1nc2c(-c3ccncc3)nc(-n3cnc4ccc(Cl)cc43)nc2n1C1CCC(=O)CC1 |
| InChI | InChI=1S/C24H20ClN7O/c1-14-28-22-21(15-8-10-26-11-9-15)29-24(31-13-27-19-7-2-16(25)12-20(19)31)30-23(22)32(14)17-3-5-18(33)6-4-17/h2,7-13,17H,3-6H2,1H3 |
| InChIKey | MBSZNKYMBPXWIX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |