C14H15Cl2N3O — CID 115471621
5-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one (PubChem CID 115471621) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 5-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one.
| Compound Name | 5-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 115471621 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-[6-chloro-2-(chloromethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one |
| SMILES | CN1CC(n2c(CCl)nc3ccc(Cl)cc32)CCC1=O |
| InChI | InChI=1S/C14H15Cl2N3O/c1-18-8-10(3-5-14(18)20)19-12-6-9(16)2-4-11(12)17-13(19)7-15/h2,4,6,10H,3,5,7-8H2,1H3 |
| InChIKey | UNMNOKJHZCEQHO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|