C16H14Cl2N2S — CID 115471476
6-chloro-2-(chloromethyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazole (PubChem CID 115471476) has the molecular formula C16H14Cl2N2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazole |
|---|---|
| PubChem CID | 115471476 |
| Molecular Formula | C16H14Cl2N2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzimidazole |
| SMILES | ClCc1nc2ccc(Cl)cc2n1C1CCCc2sccc21 |
| InChI | InChI=1S/C16H14Cl2N2S/c17-9-16-19-12-5-4-10(18)8-14(12)20(16)13-2-1-3-15-11(13)6-7-21-15/h4-8,13H,1-3,9H2 |
| InChIKey | FLFPCWUDVOCTMD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|