C15H19Cl2N3 — CID 115471775
6-chloro-2-(chloromethyl)-1-(1,2-dimethylpiperidin-4-yl)benzimidazole (PubChem CID 115471775) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-1-(1,2-dimethylpiperidin-4-yl)benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-1-(1,2-dimethylpiperidin-4-yl)benzimidazole |
|---|---|
| PubChem CID | 115471775 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-1-(1,2-dimethylpiperidin-4-yl)benzimidazole |
| SMILES | CC1CC(n2c(CCl)nc3ccc(Cl)cc32)CCN1C |
| InChI | InChI=1S/C15H19Cl2N3/c1-10-7-12(5-6-19(10)2)20-14-8-11(17)3-4-13(14)18-15(20)9-16/h3-4,8,10,12H,5-7,9H2,1-2H3 |
| InChIKey | XTIQJYWOWIHXME-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|