C17H20ClN3 — CID 104715836
2-(chloromethyl)-3-(3,5-dimethylcyclohexyl)benzimidazole-5-carbonitrile (PubChem CID 104715836) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(3,5-dimethylcyclohexyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-(chloromethyl)-3-(3,5-dimethylcyclohexyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104715836 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(chloromethyl)-3-(3,5-dimethylcyclohexyl)benzimidazole-5-carbonitrile |
| SMILES | CC1CC(C)CC(n2c(CCl)nc3ccc(C#N)cc32)C1 |
| InChI | InChI=1S/C17H20ClN3/c1-11-5-12(2)7-14(6-11)21-16-8-13(10-19)3-4-15(16)20-17(21)9-18/h3-4,8,11-12,14H,5-7,9H2,1-2H3 |
| InChIKey | NJKOKFKJSDNPRG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|