C14H14ClN3 — CID 113444574
2-(chloromethyl)-3-(cyclobutylmethyl)benzimidazole-5-carbonitrile (PubChem CID 113444574) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(cyclobutylmethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-(chloromethyl)-3-(cyclobutylmethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 113444574 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(chloromethyl)-3-(cyclobutylmethyl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(CCl)n(CC3CCC3)c2c1 |
| InChI | InChI=1S/C14H14ClN3/c15-7-14-17-12-5-4-11(8-16)6-13(12)18(14)9-10-2-1-3-10/h4-6,10H,1-3,7,9H2 |
| InChIKey | WOSCLRLYSKWLGE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|