C13H13N3 — CID 104712508
2-(cyclopropylmethyl)-3-methylbenzimidazole-5-carbonitrile (PubChem CID 104712508) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3-methylbenzimidazole-5-carbonitrile.
| Compound Name | 2-(cyclopropylmethyl)-3-methylbenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104712508 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(cyclopropylmethyl)-3-methylbenzimidazole-5-carbonitrile |
| SMILES | Cn1c(CC2CC2)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C13H13N3/c1-16-12-6-10(8-14)4-5-11(12)15-13(16)7-9-2-3-9/h4-6,9H,2-3,7H2,1H3 |
| InChIKey | VJOKYGZRNFDXLJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |