C14H16N4 — CID 84629734
2-[2-(cyclopropylamino)ethyl]-3-methylbenzimidazole-5-carbonitrile (PubChem CID 84629734) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[2-(cyclopropylamino)ethyl]-3-methylbenzimidazole-5-carbonitrile.
| Compound Name | 2-[2-(cyclopropylamino)ethyl]-3-methylbenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 84629734 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[2-(cyclopropylamino)ethyl]-3-methylbenzimidazole-5-carbonitrile |
| SMILES | Cn1c(CCNC2CC2)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C14H16N4/c1-18-13-8-10(9-15)2-5-12(13)17-14(18)6-7-16-11-3-4-11/h2,5,8,11,16H,3-4,6-7H2,1H3 |
| InChIKey | SAOLBBONZRJLRQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |