C13H14Cl2N2O — CID 118114327
3-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]cyclopentan-1-ol (PubChem CID 118114327) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 3-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]cyclopentan-1-ol.
| Compound Name | 3-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 118114327 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-[5-chloro-2-(chloromethyl)benzimidazol-1-yl]cyclopentan-1-ol |
| SMILES | OC1CCC(n2c(CCl)nc3cc(Cl)ccc32)C1 |
| InChI | InChI=1S/C13H14Cl2N2O/c14-7-13-16-11-5-8(15)1-4-12(11)17(13)9-2-3-10(18)6-9/h1,4-5,9-10,18H,2-3,6-7H2 |
| InChIKey | YDWIOGDNAFMGKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|