C15H17Cl2N3O — CID 64667410
5-[5-chloro-2-(2-chloroethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one (PubChem CID 64667410) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is 5-[5-chloro-2-(2-chloroethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one.
| Compound Name | 5-[5-chloro-2-(2-chloroethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 64667410 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-[5-chloro-2-(2-chloroethyl)benzimidazol-1-yl]-1-methylpiperidin-2-one |
| SMILES | CN1CC(n2c(CCCl)nc3cc(Cl)ccc32)CCC1=O |
| InChI | InChI=1S/C15H17Cl2N3O/c1-19-9-11(3-5-15(19)21)20-13-4-2-10(17)8-12(13)18-14(20)6-7-16/h2,4,8,11H,3,5-7,9H2,1H3 |
| InChIKey | PRPZSXFVLZWFEO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|