C25H26N4O4S — CID 46286860
3-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-4-yl]-2-phenylimidazo[4,5-b]pyridine (PubChem CID 46286860) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-4-yl]-2-phenylimidazo[4,5-b]pyridine.
| Compound Name | 3-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-4-yl]-2-phenylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 46286860 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 3-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-4-yl]-2-phenylimidazo[4,5-b]pyridine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC(n3c(-c4ccccc4)nc4cccnc43)CC2)c1 |
| InChI | InChI=1S/C25H26N4O4S/c1-32-20-10-11-22(33-2)23(17-20)34(30,31)28-15-12-19(13-16-28)29-24(18-7-4-3-5-8-18)27-21-9-6-14-26-25(21)29/h3-11,14,17,19H,12-13,15-16H2,1-2H3 |
| InChIKey | IGFMZTPKJSVGOE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |