C22H24ClN5O2S — CID 143003172
5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 143003172) has the molecular formula C22H24ClN5O2S and a molecular weight of 457.99 g/mol. Its IUPAC name is 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143003172 |
| Molecular Formula | C22H24ClN5O2S |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2ncc(Cl)c(Nc3ccccc3SNC3CCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C22H24ClN5O2S/c1-29-15-10-11-17(19(12-15)30-2)26-22-24-13-16(23)21(27-22)25-18-8-3-4-9-20(18)31-28-14-6-5-7-14/h3-4,8-14,28H,5-7H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | IGGFBPRDKILYMA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|