C27H35ClN6O2S — CID 143003171
5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine;1-methylpyrrolidine (PubChem CID 143003171) has the molecular formula C27H35ClN6O2S and a molecular weight of 543.14 g/mol. Its IUPAC name is 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine;1-methylpyrrolidine.
| Compound Name | 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine;1-methylpyrrolidine |
|---|---|
| PubChem CID | 143003171 |
| Molecular Formula | C27H35ClN6O2S |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 5-chloro-4-N-[2-(cyclobutylamino)sulfanylphenyl]-2-N-(2,4-dimethoxyphenyl)pyrimidine-2,4-diamine;1-methylpyrrolidine |
| SMILES | CN1CCCC1.COc1ccc(Nc2ncc(Cl)c(Nc3ccccc3SNC3CCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C22H24ClN5O2S.C5H11N/c1-29-15-10-11-17(19(12-15)30-2)26-22-24-13-16(23)21(27-22)25-18-8-3-4-9-20(18)31-28-14-6-5-7-14;1-6-4-2-3-5-6/h3-4,8-14,28H,5-7H2,1-2H3,(H2,24,25,26,27);2-5H2,1H3 |
| InChIKey | NJJJKQAJIMYDLJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|