C19H18N8O — CID 174584365
8-(2-aminopyrimidin-4-yl)-9-cyclopropyl-N-(2-methoxyphenyl)purin-2-amine (PubChem CID 174584365) has the molecular formula C19H18N8O and a molecular weight of 374.41 g/mol. Its IUPAC name is 8-(2-aminopyrimidin-4-yl)-9-cyclopropyl-N-(2-methoxyphenyl)purin-2-amine.
| Compound Name | 8-(2-aminopyrimidin-4-yl)-9-cyclopropyl-N-(2-methoxyphenyl)purin-2-amine |
|---|---|
| PubChem CID | 174584365 |
| Molecular Formula | C19H18N8O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 8-(2-aminopyrimidin-4-yl)-9-cyclopropyl-N-(2-methoxyphenyl)purin-2-amine |
| SMILES | COc1ccccc1Nc1ncc2nc(-c3ccnc(N)n3)n(C3CC3)c2n1 |
| InChI | InChI=1S/C19H18N8O/c1-28-15-5-3-2-4-12(15)25-19-22-10-14-17(26-19)27(11-6-7-11)16(23-14)13-8-9-21-18(20)24-13/h2-5,8-11H,6-7H2,1H3,(H2,20,21,24)(H,22,25,26) |
| InChIKey | LSJJNILCYZRCIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |