C17H14F2N8 — CID 58441951
8-(2-aminopyrimidin-4-yl)-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine (PubChem CID 58441951) has the molecular formula C17H14F2N8 and a molecular weight of 368.35 g/mol. Its IUPAC name is 8-(2-aminopyrimidin-4-yl)-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine.
| Compound Name | 8-(2-aminopyrimidin-4-yl)-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine |
|---|---|
| PubChem CID | 58441951 |
| Molecular Formula | C17H14F2N8 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 8-(2-aminopyrimidin-4-yl)-N-(2,6-difluorophenyl)-9-ethylpurin-2-amine |
| SMILES | CCn1c(-c2ccnc(N)n2)nc2cnc(Nc3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C17H14F2N8/c1-2-27-14(11-6-7-21-16(20)24-11)23-12-8-22-17(26-15(12)27)25-13-9(18)4-3-5-10(13)19/h3-8H,2H2,1H3,(H2,20,21,24)(H,22,25,26) |
| InChIKey | QSUJBCZKUIYDAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |