C19H20N8 — CID 24745640
8-(2-aminopyrimidin-4-yl)-N-(3,5-dimethylphenyl)-9-ethylpurin-2-amine (PubChem CID 24745640) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 8-(2-aminopyrimidin-4-yl)-N-(3,5-dimethylphenyl)-9-ethylpurin-2-amine.
| Compound Name | 8-(2-aminopyrimidin-4-yl)-N-(3,5-dimethylphenyl)-9-ethylpurin-2-amine |
|---|---|
| PubChem CID | 24745640 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 8-(2-aminopyrimidin-4-yl)-N-(3,5-dimethylphenyl)-9-ethylpurin-2-amine |
| SMILES | CCn1c(-c2ccnc(N)n2)nc2cnc(Nc3cc(C)cc(C)c3)nc21 |
| InChI | InChI=1S/C19H20N8/c1-4-27-16(14-5-6-21-18(20)25-14)24-15-10-22-19(26-17(15)27)23-13-8-11(2)7-12(3)9-13/h5-10H,4H2,1-3H3,(H2,20,21,25)(H,22,23,26) |
| InChIKey | NUTDEBPDDVELNJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |