C17H14FN7 — CID 58441916
8-(2-amino-4-pyridinyl)-N-(4-fluorophenyl)-9-methylpurin-2-amine (PubChem CID 58441916) has the molecular formula C17H14FN7 and a molecular weight of 335.35 g/mol. Its IUPAC name is 8-(2-amino-4-pyridinyl)-N-(4-fluorophenyl)-9-methylpurin-2-amine.
| Compound Name | 8-(2-amino-4-pyridinyl)-N-(4-fluorophenyl)-9-methylpurin-2-amine |
|---|---|
| PubChem CID | 58441916 |
| Molecular Formula | C17H14FN7 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 8-(2-amino-4-pyridinyl)-N-(4-fluorophenyl)-9-methylpurin-2-amine |
| SMILES | Cn1c(-c2ccnc(N)c2)nc2cnc(Nc3ccc(F)cc3)nc21 |
| InChI | InChI=1S/C17H14FN7/c1-25-15(10-6-7-20-14(19)8-10)23-13-9-21-17(24-16(13)25)22-12-4-2-11(18)3-5-12/h2-9H,1H3,(H2,19,20)(H,21,22,24) |
| InChIKey | XYQZJJVYRGHMIH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |