C18H15FN6O — CID 174584208
N-(4-fluorophenyl)-8-(2-methoxy-4-pyridinyl)-9-methylpurin-2-amine (PubChem CID 174584208) has the molecular formula C18H15FN6O and a molecular weight of 350.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-8-(2-methoxy-4-pyridinyl)-9-methylpurin-2-amine.
| Compound Name | N-(4-fluorophenyl)-8-(2-methoxy-4-pyridinyl)-9-methylpurin-2-amine |
|---|---|
| PubChem CID | 174584208 |
| Molecular Formula | C18H15FN6O |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(4-fluorophenyl)-8-(2-methoxy-4-pyridinyl)-9-methylpurin-2-amine |
| SMILES | COc1cc(-c2nc3cnc(Nc4ccc(F)cc4)nc3n2C)ccn1 |
| InChI | InChI=1S/C18H15FN6O/c1-25-16(11-7-8-20-15(9-11)26-2)23-14-10-21-18(24-17(14)25)22-13-5-3-12(19)4-6-13/h3-10H,1-2H3,(H,21,22,24) |
| InChIKey | CZZJYWUGCSAWPI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |