C20H17N5O2 — CID 3233469
2-(3-methoxyanilino)-8-methyl-6-phenylpteridin-7-one (PubChem CID 3233469) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-8-methyl-6-phenylpteridin-7-one.
| Compound Name | 2-(3-methoxyanilino)-8-methyl-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233469 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(3-methoxyanilino)-8-methyl-6-phenylpteridin-7-one |
| SMILES | COc1cccc(Nc2ncc3nc(-c4ccccc4)c(=O)n(C)c3n2)c1 |
| InChI | InChI=1S/C20H17N5O2/c1-25-18-16(23-17(19(25)26)13-7-4-3-5-8-13)12-21-20(24-18)22-14-9-6-10-15(11-14)27-2/h3-12H,1-2H3,(H,21,22,24) |
| InChIKey | FOGFIDUEISRPNV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |