C24H23N5O3 — CID 3233418
2-(3-methoxyanilino)-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one (PubChem CID 3233418) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one.
| Compound Name | 2-(3-methoxyanilino)-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233418 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-(3-methoxyanilino)-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one |
| SMILES | COc1cccc(Nc2ncc3nc(-c4ccccc4)c(=O)n(C[C@H]4CCCO4)c3n2)c1 |
| InChI | InChI=1S/C24H23N5O3/c1-31-18-10-5-9-17(13-18)26-24-25-14-20-22(28-24)29(15-19-11-6-12-32-19)23(30)21(27-20)16-7-3-2-4-8-16/h2-5,7-10,13-14,19H,6,11-12,15H2,1H3,(H,25,26,28)/t19-/m1/s1 |
| InChIKey | YUUJFZVJTACOIK-LJQANCHMSA-N |
| XLogP | 3.78 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |