C18H18N4O3 — CID 3233794
2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one (PubChem CID 3233794) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one.
| Compound Name | 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233794 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]-6-phenylpteridin-7-one |
| SMILES | COc1ncc2nc(-c3ccccc3)c(=O)n(C[C@H]3CCCO3)c2n1 |
| InChI | InChI=1S/C18H18N4O3/c1-24-18-19-10-14-16(21-18)22(11-13-8-5-9-25-13)17(23)15(20-14)12-6-3-2-4-7-12/h2-4,6-7,10,13H,5,8-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | OULWOPRNRGKOBX-CYBMUJFWSA-N |
| XLogP | 2.04 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |