C26H26N4O4 — CID 3234630
2-(4-methoxyphenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one (PubChem CID 3234630) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one.
| Compound Name | 2-(4-methoxyphenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3234630 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-(4-methoxyphenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one |
| SMILES | COc1ccc(Oc2ncc3nc(CCc4ccccc4)c(=O)n(C[C@H]4CCCO4)c3n2)cc1 |
| InChI | InChI=1S/C26H26N4O4/c1-32-19-10-12-20(13-11-19)34-26-27-16-23-24(29-26)30(17-21-8-5-15-33-21)25(31)22(28-23)14-9-18-6-3-2-4-7-18/h2-4,6-7,10-13,16,21H,5,8-9,14-15,17H2,1H3/t21-/m1/s1 |
| InChIKey | WDHGYUQIEDLFSR-OAQYLSRUSA-N |
| XLogP | 3.95 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |