C12H14N4O3 — CID 3233097
2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one (PubChem CID 3233097) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one.
| Compound Name | 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
|---|---|
| PubChem CID | 3233097 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-methoxy-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
| SMILES | COc1ncc2ncc(=O)n(C[C@H]3CCCO3)c2n1 |
| InChI | InChI=1S/C12H14N4O3/c1-18-12-14-5-9-11(15-12)16(10(17)6-13-9)7-8-3-2-4-19-8/h5-6,8H,2-4,7H2,1H3/t8-/m1/s1 |
| InChIKey | VWMMLGZJAMJRKQ-MRVPVSSYSA-N |
| XLogP | 0.37 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |