C26H24N2O — CID 102110360
1-(oxolan-2-ylmethyl)-2,4,5-triphenylimidazole (PubChem CID 102110360) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-2,4,5-triphenylimidazole.
| Compound Name | 1-(oxolan-2-ylmethyl)-2,4,5-triphenylimidazole |
|---|---|
| PubChem CID | 102110360 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-2,4,5-triphenylimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)n(CC3CCCO3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O/c1-4-11-20(12-5-1)24-25(21-13-6-2-7-14-21)28(19-23-17-10-18-29-23)26(27-24)22-15-8-3-9-16-22/h1-9,11-16,23H,10,17-19H2 |
| InChIKey | HLSMMWPGESZWEQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |