C23H22N4O — CID 2926784
7-(oxolan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 2926784) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 7-(oxolan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(oxolan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2926784 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 7-(oxolan-2-ylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccccc1)c(-c1ccccc1)n2CC1CCCO1 |
| InChI | InChI=1S/C23H22N4O/c24-22-20-19(16-8-3-1-4-9-16)21(17-10-5-2-6-11-17)27(23(20)26-15-25-22)14-18-12-7-13-28-18/h1-6,8-11,15,18H,7,12-14H2,(H2,24,25,26) |
| InChIKey | SZCJSOQYDPRKQP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |