C21H19N3O — CID 50983448
3-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenylimidazol-4-yl]benzonitrile (PubChem CID 50983448) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenylimidazol-4-yl]benzonitrile.
| Compound Name | 3-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenylimidazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 50983448 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenylimidazol-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2c(-c3ccccc3)ncn2C[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C21H19N3O/c22-13-16-6-4-9-18(12-16)21-20(17-7-2-1-3-8-17)23-15-24(21)14-19-10-5-11-25-19/h1-4,6-9,12,15,19H,5,10-11,14H2/t19-/m1/s1 |
| InChIKey | KTEMVHHBDVBPDD-LJQANCHMSA-N |
| XLogP | 4.27 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |