C23H26N2O3 — CID 95138059
5-(3,4-dimethoxyphenyl)-1-[[(2S)-oxan-2-yl]methyl]-4-phenylimidazole (PubChem CID 95138059) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-1-[[(2S)-oxan-2-yl]methyl]-4-phenylimidazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-1-[[(2S)-oxan-2-yl]methyl]-4-phenylimidazole |
|---|---|
| PubChem CID | 95138059 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-1-[[(2S)-oxan-2-yl]methyl]-4-phenylimidazole |
| SMILES | COc1ccc(-c2c(-c3ccccc3)ncn2C[C@@H]2CCCCO2)cc1OC |
| InChI | InChI=1S/C23H26N2O3/c1-26-20-12-11-18(14-21(20)27-2)23-22(17-8-4-3-5-9-17)24-16-25(23)15-19-10-6-7-13-28-19/h3-5,8-9,11-12,14,16,19H,6-7,10,13,15H2,1-2H3/t19-/m0/s1 |
| InChIKey | NMGFYQIQIYMUDC-IBGZPJMESA-N |
| XLogP | 4.80 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |