C17H16N2O2S — CID 90331972
3-(oxolan-2-ylmethyl)-7-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 90331972) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-7-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(oxolan-2-ylmethyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 90331972 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-7-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2scc(-c3ccccc3)c2ncn1CC1CCCO1 |
| InChI | InChI=1S/C17H16N2O2S/c20-17-16-15(14(10-22-16)12-5-2-1-3-6-12)18-11-19(17)9-13-7-4-8-21-13/h1-3,5-6,10-11,13H,4,7-9H2 |
| InChIKey | JYRNCJXBSSFIOX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |