C13H13N3O3S2 — CID 34925223
5-[[(2R)-oxolan-2-yl]methyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione (PubChem CID 34925223) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-[[(2R)-oxolan-2-yl]methyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione.
| Compound Name | 5-[[(2R)-oxolan-2-yl]methyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
|---|---|
| PubChem CID | 34925223 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 5-[[(2R)-oxolan-2-yl]methyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
| SMILES | O=C1CSc2sc3c(=O)n(C[C@H]4CCCO4)cnc3c2N1 |
| InChI | InChI=1S/C13H13N3O3S2/c17-8-5-20-13-10(15-8)9-11(21-13)12(18)16(6-14-9)4-7-2-1-3-19-7/h6-7H,1-5H2,(H,15,17)/t7-/m1/s1 |
| InChIKey | FBADGHJFSKWFKR-SSDOTTSWSA-N |
| XLogP | 1.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |