C20H19ClN4O3S2 — CID 51699311
5-[(2R)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione (PubChem CID 51699311) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 5-[(2R)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione.
| Compound Name | 5-[(2R)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
|---|---|
| PubChem CID | 51699311 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 5-[(2R)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
| SMILES | O=C1CSc2sc3c(=O)n(C[C@@H](c4ccc(Cl)cc4)N4CCOCC4)cnc3c2N1 |
| InChI | InChI=1S/C20H19ClN4O3S2/c21-13-3-1-12(2-4-13)14(24-5-7-28-8-6-24)9-25-11-22-16-17-20(29-10-15(26)23-17)30-18(16)19(25)27/h1-4,11,14H,5-10H2,(H,23,26)/t14-/m0/s1 |
| InChIKey | ZYNDAPVATKOZNU-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |