C16H21ClN4O — CID 119110534
2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrazol-5-ylmethyl)ethanamine (PubChem CID 119110534) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrazol-5-ylmethyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 119110534 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrazol-5-ylmethyl)ethanamine |
| SMILES | Clc1ccc(C(CNCc2ccn[nH]2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21ClN4O/c17-14-3-1-13(2-4-14)16(21-7-9-22-10-8-21)12-18-11-15-5-6-19-20-15/h1-6,16,18H,7-12H2,(H,19,20) |
| InChIKey | BQDMOQZBRCLOBN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |