C21H25ClN4O — CID 119110535
2-(4-chlorophenyl)-N-[(1-methylbenzimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 119110535) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(1-methylbenzimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[(1-methylbenzimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 119110535 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(1-methylbenzimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cn1c(CNCC(c2ccc(Cl)cc2)N2CCOCC2)nc2ccccc21 |
| InChI | InChI=1S/C21H25ClN4O/c1-25-19-5-3-2-4-18(19)24-21(25)15-23-14-20(26-10-12-27-13-11-26)16-6-8-17(22)9-7-16/h2-9,20,23H,10-15H2,1H3 |
| InChIKey | MLHOJVMAQBPACA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |