C19H20ClN3O2 — CID 71883513
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1,3-benzoxazol-2-amine (PubChem CID 71883513) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 71883513 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1,3-benzoxazol-2-amine |
| SMILES | Clc1ccc(C(CNc2nc3ccccc3o2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-15-7-5-14(6-8-15)17(23-9-11-24-12-10-23)13-21-19-22-16-3-1-2-4-18(16)25-19/h1-8,17H,9-13H2,(H,21,22) |
| InChIKey | GAIMLIXGLRKLMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |