C17H19N3O2 — CID 51308914
N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzoxazol-2-amine (PubChem CID 51308914) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 51308914 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzoxazol-2-amine |
| SMILES | c1coc(C(CNc2nc3ccccc3o2)N2CCCC2)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-2-7-15-13(6-1)19-17(22-15)18-12-14(16-8-5-11-21-16)20-9-3-4-10-20/h1-2,5-8,11,14H,3-4,9-10,12H2,(H,18,19) |
| InChIKey | WPPFWPZZWZAPET-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |