C15H26N2O — CID 83380875
N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylpropan-1-amine (PubChem CID 83380875) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 83380875 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C15H26N2O/c1-13(2)11-16-12-14(15-7-6-10-18-15)17-8-4-3-5-9-17/h6-7,10,13-14,16H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | SSRKUBNRLIJBDB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |