C15H19BrN2OS — CID 17483105
N-[(4-bromothiophen-2-yl)methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine (PubChem CID 17483105) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 17483105 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine |
| SMILES | Brc1csc(CNCC(c2ccco2)N2CCCC2)c1 |
| InChI | InChI=1S/C15H19BrN2OS/c16-12-8-13(20-11-12)9-17-10-14(15-4-3-7-19-15)18-5-1-2-6-18/h3-4,7-8,11,14,17H,1-2,5-6,9-10H2 |
| InChIKey | CSDJFRMYZSIYRR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |