C17H22ClN3O — CID 126769820
2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrrol-3-ylmethyl)ethanamine (PubChem CID 126769820) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrrol-3-ylmethyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrrol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 126769820 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(4-chlorophenyl)-2-morpholin-4-yl-N-(1H-pyrrol-3-ylmethyl)ethanamine |
| SMILES | Clc1ccc(C(CNCc2cc[nH]c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H22ClN3O/c18-16-3-1-15(2-4-16)17(21-7-9-22-10-8-21)13-20-12-14-5-6-19-11-14/h1-6,11,17,19-20H,7-10,12-13H2 |
| InChIKey | ASQJOASVVHLXEN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |