C18H18N4O4S2 — CID 51699283
5-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione (PubChem CID 51699283) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione.
| Compound Name | 5-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
|---|---|
| PubChem CID | 51699283 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 5-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
| SMILES | O=C1CSc2sc3c(=O)n(C[C@@H](c4ccco4)N4CCOCC4)cnc3c2N1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-13-9-27-18-15(20-13)14-16(28-18)17(24)22(10-19-14)8-11(12-2-1-5-26-12)21-3-6-25-7-4-21/h1-2,5,10-11H,3-4,6-9H2,(H,20,23)/t11-/m0/s1 |
| InChIKey | MKILHEXDGJIWOK-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |