C21H22FN5O3 — CID 3234605
6-(4-fluorophenyl)-2-morpholin-4-yl-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one (PubChem CID 3234605) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-morpholin-4-yl-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one.
| Compound Name | 6-(4-fluorophenyl)-2-morpholin-4-yl-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
|---|---|
| PubChem CID | 3234605 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 6-(4-fluorophenyl)-2-morpholin-4-yl-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
| SMILES | O=c1c(-c2ccc(F)cc2)nc2cnc(N3CCOCC3)nc2n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H22FN5O3/c22-15-5-3-14(4-6-15)18-20(28)27(13-16-2-1-9-30-16)19-17(24-18)12-23-21(25-19)26-7-10-29-11-8-26/h3-6,12,16H,1-2,7-11,13H2/t16-/m1/s1 |
| InChIKey | VLGZIOCSTOWUFA-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |