C22H17F2N5O2 — CID 3235426
8-cyclopropyl-6-(3,5-difluorophenyl)-2-(3-methoxyanilino)pteridin-7-one (PubChem CID 3235426) has the molecular formula C22H17F2N5O2 and a molecular weight of 421.41 g/mol. Its IUPAC name is 8-cyclopropyl-6-(3,5-difluorophenyl)-2-(3-methoxyanilino)pteridin-7-one.
| Compound Name | 8-cyclopropyl-6-(3,5-difluorophenyl)-2-(3-methoxyanilino)pteridin-7-one |
|---|---|
| PubChem CID | 3235426 |
| Molecular Formula | C22H17F2N5O2 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 8-cyclopropyl-6-(3,5-difluorophenyl)-2-(3-methoxyanilino)pteridin-7-one |
| SMILES | COc1cccc(Nc2ncc3nc(-c4cc(F)cc(F)c4)c(=O)n(C4CC4)c3n2)c1 |
| InChI | InChI=1S/C22H17F2N5O2/c1-31-17-4-2-3-15(10-17)26-22-25-11-18-20(28-22)29(16-5-6-16)21(30)19(27-18)12-7-13(23)9-14(24)8-12/h2-4,7-11,16H,5-6H2,1H3,(H,25,26,28) |
| InChIKey | DDPRPTZODSTNNV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |