C27H21N5O3 — CID 24936706
N-[3-(2-anilino-8-methoxy-7-oxopyrido[2,3-d]pyrimidin-6-yl)phenyl]benzamide (PubChem CID 24936706) has the molecular formula C27H21N5O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-[3-(2-anilino-8-methoxy-7-oxopyrido[2,3-d]pyrimidin-6-yl)phenyl]benzamide.
| Compound Name | N-[3-(2-anilino-8-methoxy-7-oxopyrido[2,3-d]pyrimidin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 24936706 |
| Molecular Formula | C27H21N5O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[3-(2-anilino-8-methoxy-7-oxopyrido[2,3-d]pyrimidin-6-yl)phenyl]benzamide |
| SMILES | COn1c(=O)c(-c2cccc(NC(=O)c3ccccc3)c2)cc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C27H21N5O3/c1-35-32-24-20(17-28-27(31-24)30-21-12-6-3-7-13-21)16-23(26(32)34)19-11-8-14-22(15-19)29-25(33)18-9-4-2-5-10-18/h2-17H,1H3,(H,29,33)(H,28,30,31) |
| InChIKey | YVRQGDGFQWNYIS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |