C21H15Cl2N5O3 — CID 76775743
6-(2,6-dichlorophenyl)-2-[4-(hydroxyiminomethyl)anilino]-8-methoxypyrido[2,3-d]pyrimidin-7-one (PubChem CID 76775743) has the molecular formula C21H15Cl2N5O3 and a molecular weight of 456.29 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(hydroxyiminomethyl)anilino]-8-methoxypyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(hydroxyiminomethyl)anilino]-8-methoxypyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 76775743 |
| Molecular Formula | C21H15Cl2N5O3 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(hydroxyiminomethyl)anilino]-8-methoxypyrido[2,3-d]pyrimidin-7-one |
| SMILES | COn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(Nc3ccc(C=NO)cc3)nc21 |
| InChI | InChI=1S/C21H15Cl2N5O3/c1-31-28-19-13(9-15(20(28)29)18-16(22)3-2-4-17(18)23)11-24-21(27-19)26-14-7-5-12(6-8-14)10-25-30/h2-11,30H,1H3,(H,24,26,27) |
| InChIKey | DNFBINVPQOBKPP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|