C15H15N5O2 — CID 3233678
2-(3-methoxyanilino)-6,8-dimethylpteridin-7-one (PubChem CID 3233678) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-6,8-dimethylpteridin-7-one.
| Compound Name | 2-(3-methoxyanilino)-6,8-dimethylpteridin-7-one |
|---|---|
| PubChem CID | 3233678 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(3-methoxyanilino)-6,8-dimethylpteridin-7-one |
| SMILES | COc1cccc(Nc2ncc3nc(C)c(=O)n(C)c3n2)c1 |
| InChI | InChI=1S/C15H15N5O2/c1-9-14(21)20(2)13-12(17-9)8-16-15(19-13)18-10-5-4-6-11(7-10)22-3/h4-8H,1-3H3,(H,16,18,19) |
| InChIKey | CVCXLDXDKXGULY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |