C23H21Cl2N5O3 — CID 24937334
8-(3-aminopropoxy)-6-(2,6-dichlorophenyl)-2-(3-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 24937334) has the molecular formula C23H21Cl2N5O3 and a molecular weight of 486.36 g/mol. Its IUPAC name is 8-(3-aminopropoxy)-6-(2,6-dichlorophenyl)-2-(3-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(3-aminopropoxy)-6-(2,6-dichlorophenyl)-2-(3-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 24937334 |
| Molecular Formula | C23H21Cl2N5O3 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 8-(3-aminopropoxy)-6-(2,6-dichlorophenyl)-2-(3-methoxyanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1cccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(OCCCN)c3n2)c1 |
| InChI | InChI=1S/C23H21Cl2N5O3/c1-32-16-6-2-5-15(12-16)28-23-27-13-14-11-17(20-18(24)7-3-8-19(20)25)22(31)30(21(14)29-23)33-10-4-9-26/h2-3,5-8,11-13H,4,9-10,26H2,1H3,(H,27,28,29) |
| InChIKey | VCDJOABGCOPPHU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|