C25H19F3N6O2 — CID 168843620
2-N,9-bis(4-methoxyphenyl)-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine (PubChem CID 168843620) has the molecular formula C25H19F3N6O2 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-N,9-bis(4-methoxyphenyl)-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine.
| Compound Name | 2-N,9-bis(4-methoxyphenyl)-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 168843620 |
| Molecular Formula | C25H19F3N6O2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-N,9-bis(4-methoxyphenyl)-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine |
| SMILES | COc1ccc(Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n(-c4ccc(OC)cc4)c3n2)cc1 |
| InChI | InChI=1S/C25H19F3N6O2/c1-35-17-7-3-15(4-8-17)30-24-29-13-21-23(33-24)34(16-5-9-18(36-2)10-6-16)25(31-21)32-22-19(27)11-14(26)12-20(22)28/h3-13H,1-2H3,(H,31,32)(H,29,30,33) |
| InChIKey | WQKQWOKCQCMCKU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |