C26H21F2N5O — CID 58973765
8-(3-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-9-(3-methoxyphenyl)purin-2-amine (PubChem CID 58973765) has the molecular formula C26H21F2N5O and a molecular weight of 457.48 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-9-(3-methoxyphenyl)purin-2-amine.
| Compound Name | 8-(3-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-9-(3-methoxyphenyl)purin-2-amine |
|---|---|
| PubChem CID | 58973765 |
| Molecular Formula | C26H21F2N5O |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 8-(3-fluorophenyl)-N-[2-(2-fluorophenyl)ethyl]-9-(3-methoxyphenyl)purin-2-amine |
| SMILES | COc1cccc(-n2c(-c3cccc(F)c3)nc3cnc(NCCc4ccccc4F)nc32)c1 |
| InChI | InChI=1S/C26H21F2N5O/c1-34-21-10-5-9-20(15-21)33-24(18-7-4-8-19(27)14-18)31-23-16-30-26(32-25(23)33)29-13-12-17-6-2-3-11-22(17)28/h2-11,14-16H,12-13H2,1H3,(H,29,30,32) |
| InChIKey | YAHOBSQHOOLRFW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |